cas: 2387560-06-5 — see every product listed under this CAS number, including other names
Tert-butyl(5r)-3,3-difluoro-5-hydroxy-piperidine-1-carboxylate, 97% (CAS 2387560-06-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F718977-100MG |
| cas | 2387560-06-5 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1570.30 Pln | |
| Fluorochem | 250mg | 2444.99 Pln | |
| Fluorochem | 500mg | 3986.11 Pln | |
| Fluorochem | 1g | 5922.93 Pln | |
| Fluorochem | 5g | 17283.52 Pln | |
| Fluorochem | 10g | 28758.64 Pln | |
| Chemat | 100mg | 933.20 Pln | |
| Chemat | 250mg | 1456.40 Pln | |
| Chemat | 500mg | 2392.40 Pln | |
| Chemat | 1g | 3549.20 Pln | |
| Chemat | 5g | 10528.40 Pln | |
| Chemat | 10g | 17507.60 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
Tert-butyl (5R)-3,3-difluoro-5-hydroxypiperidine-1-carboxylate (CAS 2387560-06-5) is a chemical compound with the molecular formula C10H17F2NO3 and a molecular weight of 237.24 g/mol. IUPAC name: tert-butyl (5R)-3,3-difluoro-5-hydroxypiperidine-1-carboxylate. InChIKey: NCHCRPISXZGPTH-SSDOTTSWSA-N.
| Molecular formula | C10H17F2NO3 |
|---|---|
| Molecular weight | 237.24 g/mol |
| IUPAC name | tert-butyl (5R)-3,3-difluoro-5-hydroxypiperidine-1-carboxylate |
| InChIKey | NCHCRPISXZGPTH-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](CC(C1)(F)F)O |
Computed by PubChem (NCBI)