Tetra-n-butylammonium Di-tert-butylphosphate, 95%
cas: 68695-48-7 — see every product listed under this CAS number, including other names
Tetra-n-butylammonium Di-tert-butylphosphate, 95% (CAS 68695-48-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A179473-250mg |
| cas | 68695-48-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 248.00 Pln | |
| Ambeed | 10g | 403.75 Pln | |
| Ambeed | 25g | 526.12 Pln | |
| Ambeed | 100g | 1877.81 Pln | |
| BLDpharm | 250mg | 136.64 Pln | |
| BLDpharm | 1g | 153.30 Pln | |
| BLDpharm | 5g | 264.38 Pln | |
| BLDpharm | 10g | 430.98 Pln | |
| BLDpharm | 25g | 536.50 Pln | |
| BLDpharm | 100g | 1924.90 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Ditert-butyl phosphate;tetrabutylazanium (CAS 68695-48-7) is a chemical compound with the molecular formula C24H54NO4P and a molecular weight of 451.7 g/mol. IUPAC name: ditert-butyl phosphate;tetrabutylazanium. InChIKey: ZMBZPMVMLZIOPS-UHFFFAOYSA-M.
| Molecular formula | C24H54NO4P |
|---|---|
| Molecular weight | 451.7 g/mol |
| IUPAC name | ditert-butyl phosphate;tetrabutylazanium |
| InChIKey | ZMBZPMVMLZIOPS-UHFFFAOYSA-M |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.CC(C)(C)OP(=O)([O-])OC(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
Tetra-n-butylammonium di-tert-butylphosphate, Tetrabutylammonium di-tert-butyl phosphate, ditert-butyl phosphate;tetrabutylazanium, ZMBZPMVMLZIOPS-UHFFFAOYSA-M, tetrabutylammonium di-t-butylphosphate, ditert-butyl phosphate;tetrabutylammonium, tetrabutylammonium di-tert-butylphosphate, tetrabutylazanium di-tert-butyl phosphate, tetrabutyl ammonium di-tert-butyl phosphate, Tetra-n-butylammonium di-tert-butyl phosphate
