CAS 68695-48-7 appears in our catalog under these names: Tetra–n–butylammonium Di–tert–butylphosphate, Tetra-n-butylammonium Di-tert-butylphosphate 95%, Tetra-n-butylammonium Di-tert-butylphosphate(1:1.2-1.5) 95% (Ammonium:phosphate~1.2-1.5), Tetrabutylammonium di-tert-butyl phosphate, 95% (Ammonium:phosphate~1.2-1.5), 95% (Ammonium:phosphate~1.2-1.5), Tetra-n-butylammonium Di-tert-butylphosphate(1:1.2-1.5), 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 10g, 25g, 100g, 50g, 500g.
Ditert-butyl phosphate;tetrabutylazanium (CAS 68695-48-7) is a chemical compound with the molecular formula C24H54NO4P and a molecular weight of 451.7 g/mol. IUPAC name: ditert-butyl phosphate;tetrabutylazanium. InChIKey: ZMBZPMVMLZIOPS-UHFFFAOYSA-M.
| Molecular formula | C24H54NO4P |
|---|---|
| Molecular weight | 451.7 g/mol |
| IUPAC name | ditert-butyl phosphate;tetrabutylazanium |
| InChIKey | ZMBZPMVMLZIOPS-UHFFFAOYSA-M |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.CC(C)(C)OP(=O)([O-])OC(C)(C)C |
Computed by PubChem (NCBI)