cas: 311-28-4 — see every product listed under this CAS number, including other names
Tetra-n-butylammonium iodide, 98%, 98% (CAS 311-28-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 50g, 100g, 250g, 500g, 1kg, 5kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11435W-5g |
| cas | 311-28-4 |
| size | 5g |
| availability | 50000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 74.00 Pln | |
| Chemat | 50g | 102.80 Pln | |
| Chemat | 100g | 117.20 Pln | |
| Chemat | 250g | 189.20 Pln | |
| Chemat | 500g | 384.00 Pln | |
| Chemat | 1kg | 683.60 Pln | |
| Chemat | 5kg | 3710.40 Pln | |
| Chemat | 10kg | price on request |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tetrabutylazanium iodide (CAS 311-28-4) is a chemical compound with the molecular formula C16H36IN and a molecular weight of 369.37 g/mol. IUPAC name: tetrabutylazanium iodide. InChIKey: DPKBAXPHAYBPRL-UHFFFAOYSA-M.
| Molecular formula | C16H36IN |
|---|---|
| Molecular weight | 369.37 g/mol |
| IUPAC name | tetrabutylazanium iodide |
| InChIKey | DPKBAXPHAYBPRL-UHFFFAOYSA-M |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.[I-] |
Computed by PubChem (NCBI)