CAS 311-28-4 appears in our catalog under these names: Tetrabutylammonium Iodide, Tetra-n-butylammonium Iodide, Tetra-n-butylammonium iodide/ 98%, Tetra–n–butylammonium iodide, Tetra-n-butylammonium iodide, 98% . Offered by: Chemat Brand, TRC, Chemat, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: on request, 25g, 1kg, 100g, 250g, 500g, 1000g, 50g.
Tetrabutylazanium iodide (CAS 311-28-4) is a chemical compound with the molecular formula C16H36IN and a molecular weight of 369.37 g/mol. IUPAC name: tetrabutylazanium iodide. InChIKey: DPKBAXPHAYBPRL-UHFFFAOYSA-M.
| Molecular formula | C16H36IN |
|---|---|
| Molecular weight | 369.37 g/mol |
| IUPAC name | tetrabutylazanium iodide |
| InChIKey | DPKBAXPHAYBPRL-UHFFFAOYSA-M |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.[I-] |
Computed by PubChem (NCBI)