CAS 56211-70-2 appears in our catalog under these names: Tetrapropylammonium bisulfate, 95%, Tetrapropylammonium Bisulfate, Tetrapropylammonium Bisulfate, Tetra-n-propylammonium hydrogen sulfate, 98% , Tetra-n-propylammonium hydrogen sulfate. Offered by: Combi-blocks, TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 1g, 25g, 5g, 100mg, 2,5g, 250mg, 250g, 100g.
Hydrogen sulfate;tetrapropylazanium (CAS 56211-70-2) is a chemical compound with the molecular formula C12H29NO4S and a molecular weight of 283.43 g/mol. IUPAC name: hydrogen sulfate;tetrapropylazanium. InChIKey: MOXJKKOSZCHGEU-UHFFFAOYSA-M.
| Molecular formula | C12H29NO4S |
|---|---|
| Molecular weight | 283.43 g/mol |
| IUPAC name | hydrogen sulfate;tetrapropylazanium |
| InChIKey | MOXJKKOSZCHGEU-UHFFFAOYSA-M |
| SMILES | CCC[N+](CCC)(CCC)CCC.OS(=O)(=O)[O-] |
Computed by PubChem (NCBI)