cas: 2498-20-6 — see every product listed under this CAS number, including other names
Tetraamylammonium Iodide, >98.0%(T) (CAS 2498-20-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T1011-5G |
| cas | 2498-20-6 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 236.36 Pln | |
| TCI | 25g | 865.77 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
Tetrapentylazanium iodide (CAS 2498-20-6) is a chemical compound with the molecular formula C20H44IN and a molecular weight of 425.5 g/mol. IUPAC name: tetrapentylazanium iodide. InChIKey: FBLZDUAOBOMSNZ-UHFFFAOYSA-M.
| Molecular formula | C20H44IN |
|---|---|
| Molecular weight | 425.5 g/mol |
| IUPAC name | tetrapentylazanium iodide |
| InChIKey | FBLZDUAOBOMSNZ-UHFFFAOYSA-M |
| SMILES | CCCCC[N+](CCCCC)(CCCCC)CCCCC.[I-] |
Computed by PubChem (NCBI)