cas: 2498-20-6 — see every product listed under this CAS number, including other names
Tetrapentylammonium iodide, 98%, 98% (CAS 2498-20-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113Q3Y-1g |
| cas | 2498-20-6 |
| size | 1g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 189.20 Pln | |
| Chemat | 10g | 275.60 Pln | |
| Chemat | 25g | 568.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tetrapentylazanium iodide (CAS 2498-20-6) is a chemical compound with the molecular formula C20H44IN and a molecular weight of 425.5 g/mol. IUPAC name: tetrapentylazanium iodide. InChIKey: FBLZDUAOBOMSNZ-UHFFFAOYSA-M.
| Molecular formula | C20H44IN |
|---|---|
| Molecular weight | 425.5 g/mol |
| IUPAC name | tetrapentylazanium iodide |
| InChIKey | FBLZDUAOBOMSNZ-UHFFFAOYSA-M |
| SMILES | CCCCC[N+](CCCCC)(CCCCC)CCCCC.[I-] |
Computed by PubChem (NCBI)