Tetrabromohydroquinone, 98%
cas: 2641-89-6 — see every product listed under this CAS number, including other names
Tetrabromohydroquinone, 98% (CAS 2641-89-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A455084-1g |
| cas | 2641-89-6 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 387.06 Pln | |
| Ambeed | 10g | 698.56 Pln | |
| Ambeed | 25g | 1638.62 Pln | |
| Ambeed | 100g | 5087.38 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 414.32 Pln | |
| BLDpharm | 10g | 747.54 Pln | |
| BLDpharm | 25g | 1758.29 Pln | |
| BLDpharm | 100g | 5479.21 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2,3,5,6-tetrabromobenzene-1,4-diol (CAS 2641-89-6) is a chemical compound with the molecular formula C6H2Br4O2 and a molecular weight of 425.69 g/mol. IUPAC name: 2,3,5,6-tetrabromobenzene-1,4-diol. InChIKey: DTFQULSULHRJOA-UHFFFAOYSA-N.
| Molecular formula | C6H2Br4O2 |
|---|---|
| Molecular weight | 425.69 g/mol |
| IUPAC name | 2,3,5,6-tetrabromobenzene-1,4-diol |
| InChIKey | DTFQULSULHRJOA-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1Br)Br)O)Br)Br)O |
Computed by PubChem (NCBI)
Synonyms:
2,3,5,6-Tetrabromohydroquinone, 2,3,5,6-tetrabromo-1,4-benzenediol, Tetrabromohydroquinone, 2,3,5,6-tetrabromobenzene-1,4-diol, 1,4-Benzenediol, 2,3,5,6-tetrabromo-, tetrabromobenzene-1,4-diol, Tetrabromohydroquinone, 98%, 1,2,4,5-Tetrabromo-3,6-dihydroxybenzene, Tetrabromoquinol, DTFQULSULHRJOA-UHFFFAOYSA-N