CAS 2641-89-6 appears in our catalog under these names: Tetrabromohydroquinone, 95%, Tetrabromohydroquinone, Tetrabromohydroquinone, >97.0%(GC), Tetrabromohydroquinone 98%, Tetrabromohydroquinone, 95%, 95%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 25g, 1g, 5g, 10g, 100g, 100mg, 250mg.
2,3,5,6-tetrabromobenzene-1,4-diol (CAS 2641-89-6) is a chemical compound with the molecular formula C6H2Br4O2 and a molecular weight of 425.69 g/mol. IUPAC name: 2,3,5,6-tetrabromobenzene-1,4-diol. InChIKey: DTFQULSULHRJOA-UHFFFAOYSA-N.
| Molecular formula | C6H2Br4O2 |
|---|---|
| Molecular weight | 425.69 g/mol |
| IUPAC name | 2,3,5,6-tetrabromobenzene-1,4-diol |
| InChIKey | DTFQULSULHRJOA-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1Br)Br)O)Br)Br)O |
Computed by PubChem (NCBI)