cas: 27342-69-4 — see every product listed under this CAS number, including other names
Tetraethenyltetramethylcyclotetrasiloxane, 98%, 98% (CAS 27342-69-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 15g, 25g, 50g, 100g, 200g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch132RA9-1g |
| cas | 27342-69-4 |
| size | 1g |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 10g | 170.00 Pln | |
| Chemat | 15g | 218.00 Pln | |
| Chemat | 25g | 227.60 Pln | |
| Chemat | 50g | 376.40 Pln | |
| Chemat | 100g | 688.40 Pln | |
| Chemat | 200g | 1254.80 Pln | |
| Chemat | 300g | 1830.80 Pln | |
| Chemat | 500g | 2625.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,4,6,8-tetrakis(ethenyl)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (CAS 27342-69-4) is a chemical compound with the molecular formula C12H24O4Si4 and a molecular weight of 344.66 g/mol. IUPAC name: 2,4,6,8-tetrakis(ethenyl)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane. InChIKey: VMAWODUEPLAHOE-UHFFFAOYSA-N.
| Molecular formula | C12H24O4Si4 |
|---|---|
| Molecular weight | 344.66 g/mol |
| IUPAC name | 2,4,6,8-tetrakis(ethenyl)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| InChIKey | VMAWODUEPLAHOE-UHFFFAOYSA-N |
| SMILES | C[Si]1(O[Si](O[Si](O[Si](O1)(C)C=C)(C)C=C)(C)C=C)C=C |
Computed by PubChem (NCBI)