CAS 27342-69-4 is the registry number for Tetraethenyltetramethylcyclotetrasiloxane, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 15g, 25g, 50g, 100g, 200g.
2,4,6,8-tetrakis(ethenyl)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (CAS 27342-69-4) is a chemical compound with the molecular formula C12H24O4Si4 and a molecular weight of 344.66 g/mol. IUPAC name: 2,4,6,8-tetrakis(ethenyl)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane. InChIKey: VMAWODUEPLAHOE-UHFFFAOYSA-N.
| Molecular formula | C12H24O4Si4 |
|---|---|
| Molecular weight | 344.66 g/mol |
| IUPAC name | 2,4,6,8-tetrakis(ethenyl)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| InChIKey | VMAWODUEPLAHOE-UHFFFAOYSA-N |
| SMILES | C[Si]1(O[Si](O[Si](O[Si](O1)(C)C=C)(C)C=C)(C)C=C)C=C |
Computed by PubChem (NCBI)