Tetraethylammonium Hexafluorophosphate, 98%, 98%
cas: 429-07-2 — see every product listed under this CAS number, including other names
Tetraethylammonium Hexafluorophosphate, 98%, 98% (CAS 429-07-2) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BYIP-1kg |
| cas | 429-07-2 |
| size | 1kg |
| availability | 2000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 1485.20 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 102.80 Pln | |
| Chemat | 100g | 198.80 Pln | |
| Chemat | 500g | 825.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tetraethylazanium hexafluorophosphate (CAS 429-07-2) is a chemical compound with the molecular formula C8H20F6NP and a molecular weight of 275.22 g/mol. IUPAC name: tetraethylazanium hexafluorophosphate. InChIKey: KLKUOIXSIDDDCN-UHFFFAOYSA-N.
| Molecular formula | C8H20F6NP |
|---|---|
| Molecular weight | 275.22 g/mol |
| IUPAC name | tetraethylazanium hexafluorophosphate |
| InChIKey | KLKUOIXSIDDDCN-UHFFFAOYSA-N |
| SMILES | CC[N+](CC)(CC)CC.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
Tetraethylammonium hexafluorophosphate, Ethanaminium, N,N,N-triethyl-, hexafluorophosphate(1-), Ethanaminium, N,N,N-triethyl-, hexafluorophosphate(1-) (9CI), Tetraethylammoniumhexafluorophosphate, tetraethylazanium;hexafluorophosphate, Tetraethylammonium Hexafluorophosphate(V), Et4NPF6, Ethanaminium,N,N-triethyl-, hexafluorophosphate(1-), KLKUOIXSIDDDCN-UHFFFAOYSA-N, tetraethylammonium;hexafluorophosphate