CAS 429-07-2 appears in our catalog under these names: Tetraethylammonium hexafluorophosphate, 98%, Tetraethylammonium hexafluorophosphate, Tetraethylammonium hexafluorophosphate/ 98+%, Tetraethylammonium hexafluorophosphate, 98% , Tetraethylammonium Hexafluorophosphate, >98.0%(T). Offered by: Combi-blocks, GLPBio, Chemat, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 1g, 25g, 5g, 100g, 500g, 10g, 50g, 1000g.
Tetraethylazanium hexafluorophosphate (CAS 429-07-2) is a chemical compound with the molecular formula C8H20F6NP and a molecular weight of 275.22 g/mol. IUPAC name: tetraethylazanium hexafluorophosphate. InChIKey: KLKUOIXSIDDDCN-UHFFFAOYSA-N.
| Molecular formula | C8H20F6NP |
|---|---|
| Molecular weight | 275.22 g/mol |
| IUPAC name | tetraethylazanium hexafluorophosphate |
| InChIKey | KLKUOIXSIDDDCN-UHFFFAOYSA-N |
| SMILES | CC[N+](CC)(CC)CC.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)