CAS 16840-25-8 appears in our catalog under these names: Tetrafluorobenzene-1,3-diol, 97%, 2,4,5,6-Tetrafluorobenzene-1,3-diol, 98%, 98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
2,4,5,6-tetrafluorobenzene-1,3-diol (CAS 16840-25-8) is a chemical compound with the molecular formula C6H2F4O2 and a molecular weight of 182.07 g/mol. IUPAC name: 2,4,5,6-tetrafluorobenzene-1,3-diol. InChIKey: NLQBQVXMWOFCAU-UHFFFAOYSA-N.
| Molecular formula | C6H2F4O2 |
|---|---|
| Molecular weight | 182.07 g/mol |
| IUPAC name | 2,4,5,6-tetrafluorobenzene-1,3-diol |
| InChIKey | NLQBQVXMWOFCAU-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)O)F)O |
Computed by PubChem (NCBI)