CAS 1996-23-2 appears in our catalog under these names: Tetrafluorobenzene-1,2-diol, 95%, 3,4,5,6-Tetrafluorobenzene-1,2-diol 97%, TETRAFLUOROBENZENE-1,2-DIOL, 97%, 97%, Tetrafluorobenzene-1,2-diol, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g.
3,4,5,6-tetrafluorobenzene-1,2-diol (CAS 1996-23-2) is a chemical compound with the molecular formula C6H2F4O2 and a molecular weight of 182.07 g/mol. IUPAC name: 3,4,5,6-tetrafluorobenzene-1,2-diol. InChIKey: AQSZAISVBFUJQG-UHFFFAOYSA-N.
| Molecular formula | C6H2F4O2 |
|---|---|
| Molecular weight | 182.07 g/mol |
| IUPAC name | 3,4,5,6-tetrafluorobenzene-1,2-diol |
| InChIKey | AQSZAISVBFUJQG-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)O)O |
Computed by PubChem (NCBI)