cas: 1745-83-1 — see every product listed under this CAS number, including other names
Tetraiodo-2-sulfobenzoic Anhydride, >95.0%(T) (CAS 1745-83-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T0131-1G |
| cas | 1745-83-1 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 464.04 Pln | |
| TCI | 25g | 4083.14 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(T) |
2,3,4,5-tetraiodo-6-(2,3,4,5-tetraiodo-6-sulfobenzoyl)oxycarbonylbenzenesulfonic acid (CAS 1745-83-1) is a chemical compound with the molecular formula C14H2I8O9S2 and a molecular weight of 1393.5 g/mol. IUPAC name: 2,3,4,5-tetraiodo-6-(2,3,4,5-tetraiodo-6-sulfobenzoyl)oxycarbonylbenzenesulfonic acid. InChIKey: XIRDTHUCSQBXTN-UHFFFAOYSA-N.
| Molecular formula | C14H2I8O9S2 |
|---|---|
| Molecular weight | 1393.5 g/mol |
| IUPAC name | 2,3,4,5-tetraiodo-6-(2,3,4,5-tetraiodo-6-sulfobenzoyl)oxycarbonylbenzenesulfonic acid |
| InChIKey | XIRDTHUCSQBXTN-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1I)I)I)I)S(=O)(=O)O)C(=O)OC(=O)C2=C(C(=C(C(=C2I)I)I)I)S(=O)(=O)O |
Computed by PubChem (NCBI)