CAS 1745-83-1 appears in our catalog under these names: Tetraiodo-2-sulfobenzoic anhydride, 95%, 4,5,6,7-Tetraiodo-3H-benzo(c)(1,2)oxathiol-3-one 1,1-dioxide, 95%, Tetraiodo–2–sulfobenzoic Anhydride, Tetraiodo-2-sulfobenzoic Anhydride, >95.0%(T), Tetraiodo-2-sulfobenzoic Anhydride, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 5g, 250mg, 1g, 25g, 50mg.
2,3,4,5-tetraiodo-6-(2,3,4,5-tetraiodo-6-sulfobenzoyl)oxycarbonylbenzenesulfonic acid (CAS 1745-83-1) is a chemical compound with the molecular formula C14H2I8O9S2 and a molecular weight of 1393.5 g/mol. IUPAC name: 2,3,4,5-tetraiodo-6-(2,3,4,5-tetraiodo-6-sulfobenzoyl)oxycarbonylbenzenesulfonic acid. InChIKey: XIRDTHUCSQBXTN-UHFFFAOYSA-N.
| Molecular formula | C14H2I8O9S2 |
|---|---|
| Molecular weight | 1393.5 g/mol |
| IUPAC name | 2,3,4,5-tetraiodo-6-(2,3,4,5-tetraiodo-6-sulfobenzoyl)oxycarbonylbenzenesulfonic acid |
| InChIKey | XIRDTHUCSQBXTN-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1I)I)I)I)S(=O)(=O)O)C(=O)OC(=O)C2=C(C(=C(C(=C2I)I)I)I)S(=O)(=O)O |
Computed by PubChem (NCBI)