cas: 4136-91-8 — see every product listed under this CAS number, including other names
Tetraisopropylthiuram Disulfide, >98.0%(N) (CAS 4136-91-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T1555-5G |
| cas | 4136-91-8 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 895.27 Pln | |
| TCI | 25g | 3830.87 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(N) |
Di(propan-2-yl)carbamothioylsulfanyl N,N-di(propan-2-yl)carbamodithioate (CAS 4136-91-8) is a chemical compound with the molecular formula C14H28N2S4 and a molecular weight of 352.7 g/mol. IUPAC name: di(propan-2-yl)carbamothioylsulfanyl N,N-di(propan-2-yl)carbamodithioate. InChIKey: ZUYREEAWHZRZDX-UHFFFAOYSA-N.
| Molecular formula | C14H28N2S4 |
|---|---|
| Molecular weight | 352.7 g/mol |
| IUPAC name | di(propan-2-yl)carbamothioylsulfanyl N,N-di(propan-2-yl)carbamodithioate |
| InChIKey | ZUYREEAWHZRZDX-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)C(=S)SSC(=S)N(C(C)C)C(C)C |
Computed by PubChem (NCBI)