cas: 4136-91-8 — see every product listed under this CAS number, including other names
Tetraisopropylthiuram Disulfide (CAS 4136-91-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g. Offered by: GLPBio, Fluorochem.
| brand | GLPBio |
|---|---|
| catalog number | GF01214-1g |
| cas | 4136-91-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1g | 671.93 Pln | |
| GLPBio | 250mg | 536.19 Pln | |
| GLPBio | 5g | 1622.07 Pln | |
| Fluorochem | 250mg | 253.05 Pln | |
| Fluorochem | 1g | 450.90 Pln | |
| Fluorochem | 5g | 1226.67 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
Di(propan-2-yl)carbamothioylsulfanyl N,N-di(propan-2-yl)carbamodithioate (CAS 4136-91-8) is a chemical compound with the molecular formula C14H28N2S4 and a molecular weight of 352.7 g/mol. IUPAC name: di(propan-2-yl)carbamothioylsulfanyl N,N-di(propan-2-yl)carbamodithioate. InChIKey: ZUYREEAWHZRZDX-UHFFFAOYSA-N.
| Molecular formula | C14H28N2S4 |
|---|---|
| Molecular weight | 352.7 g/mol |
| IUPAC name | di(propan-2-yl)carbamothioylsulfanyl N,N-di(propan-2-yl)carbamodithioate |
| InChIKey | ZUYREEAWHZRZDX-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)C(=S)SSC(=S)N(C(C)C)C(C)C |
Computed by PubChem (NCBI)