cas: 58345-96-3 — see every product listed under this CAS number, including other names
Tetramethylammonium hydrogencarbonate 60 wt. % in H2O (CAS 58345-96-3) is a chemical reagent available from Chemat. Available pack sizes: 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1481550-100g |
| cas | 58345-96-3 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 242.44 Pln | |
| Ambeed | 500g | 470.50 Pln | |
| Ambeed | 1000g | 770.88 Pln |
| purity | 60 wt. % in H2O |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1481550 |
Hydrogen carbonate;tetramethylazanium (CAS 58345-96-3) is a chemical compound with the molecular formula C5H13NO3 and a molecular weight of 135.16 g/mol. IUPAC name: hydrogen carbonate;tetramethylazanium. InChIKey: VFHDWENBWYCAIB-UHFFFAOYSA-M.
| Molecular formula | C5H13NO3 |
|---|---|
| Molecular weight | 135.16 g/mol |
| IUPAC name | hydrogen carbonate;tetramethylazanium |
| InChIKey | VFHDWENBWYCAIB-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)C.C(=O)(O)[O-] |
Computed by PubChem (NCBI)