CAS 58345-96-3 appears in our catalog under these names: Tetramethylammonium hydrogencarbonate, 98%, Tetramethylammonium Bicarbonate (60% in water), Tetramethylammonium hydrogencarbonate, Tetra methyl ammonium bicarbonate, Tetramethylammonium hydrogencarbonate 60 wt. % in H2O. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: 1g, 250mg, 500mg, 5g, 100g, 500g, 1000g, 25g.
Hydrogen carbonate;tetramethylazanium (CAS 58345-96-3) is a chemical compound with the molecular formula C5H13NO3 and a molecular weight of 135.16 g/mol. IUPAC name: hydrogen carbonate;tetramethylazanium. InChIKey: VFHDWENBWYCAIB-UHFFFAOYSA-M.
| Molecular formula | C5H13NO3 |
|---|---|
| Molecular weight | 135.16 g/mol |
| IUPAC name | hydrogen carbonate;tetramethylazanium |
| InChIKey | VFHDWENBWYCAIB-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)C.C(=O)(O)[O-] |
Computed by PubChem (NCBI)