cas: 15525-15-2 — see every product listed under this CAS number, including other names
Tetraphenylphosphonium tetraphenylborate 98% (CAS 15525-15-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A925093-1g |
| cas | 15525-15-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 209.06 Pln | |
| Ambeed | 25g | 464.94 Pln | |
| Ambeed | 100g | 1366.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A925093 |
Tetraphenylboranuide;tetraphenylphosphanium (CAS 15525-15-2) is a chemical compound with the molecular formula C48H40BP and a molecular weight of 658.6 g/mol. IUPAC name: tetraphenylboranuide;tetraphenylphosphanium. InChIKey: QYFWPOPFFBCTLK-UHFFFAOYSA-N.
| Molecular formula | C48H40BP |
|---|---|
| Molecular weight | 658.6 g/mol |
| IUPAC name | tetraphenylboranuide;tetraphenylphosphanium |
| InChIKey | QYFWPOPFFBCTLK-UHFFFAOYSA-N |
| SMILES | [B-](C1=CC=CC=C1)(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.C1=CC=C(C=C1)[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)