CAS 15525-15-2 appears in our catalog under these names: Tetraphenylphosphonium tetraphenylborate, 98%, Tetraphenylphosphonium Tetraphenylborate, Tetraphenylphosphonium Tetraphenylborate, >95.0%(T), Tetraphenylphosphonium tetraphenylborate 98%, Tetraphenylphosphonium Tetraphenylborate, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 25g, 1g, 5g, 100g, 15g, 10g.
Tetraphenylboranuide;tetraphenylphosphanium (CAS 15525-15-2) is a chemical compound with the molecular formula C48H40BP and a molecular weight of 658.6 g/mol. IUPAC name: tetraphenylboranuide;tetraphenylphosphanium. InChIKey: QYFWPOPFFBCTLK-UHFFFAOYSA-N.
| Molecular formula | C48H40BP |
|---|---|
| Molecular weight | 658.6 g/mol |
| IUPAC name | tetraphenylboranuide;tetraphenylphosphanium |
| InChIKey | QYFWPOPFFBCTLK-UHFFFAOYSA-N |
| SMILES | [B-](C1=CC=CC=C1)(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.C1=CC=C(C=C1)[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)