Tetrazine-PEG5-NHS ester, 98%, 98%
cas: 1682653-80-0 — see every product listed under this CAS number, including other names
Tetrazine-PEG5-NHS ester, 98%, 98% (CAS 1682653-80-0) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HZ97-10mg |
| cas | 1682653-80-0 |
| size | 10mg |
| availability | 0.5g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 438.80 Pln | |
| Chemat | 25mg | 818.00 Pln | |
| Chemat | 50mg | 1571.60 Pln | |
| Chemat | 100mg | 2824.40 Pln | |
| Chemat | 250mg | 5306.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[3-oxo-3-[[4-(1,2,4,5-tetrazin-3-yl)phenyl]methylamino]propoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1682653-80-0) is a chemical compound with the molecular formula C27H36N6O10 and a molecular weight of 604.6 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[3-oxo-3-[[4-(1,2,4,5-tetrazin-3-yl)phenyl]methylamino]propoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: DUPHIQYIPUTDJS-UHFFFAOYSA-N.
| Molecular formula | C27H36N6O10 |
|---|---|
| Molecular weight | 604.6 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[3-oxo-3-[[4-(1,2,4,5-tetrazin-3-yl)phenyl]methylamino]propoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | DUPHIQYIPUTDJS-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCOCCC(=O)NCC2=CC=C(C=C2)C3=NN=CN=N3 |
Computed by PubChem (NCBI)