Tetrazine-Ph-PEG5-NHS ester 98%
cas: 1682653-80-0 — see every product listed under this CAS number, including other names
Tetrazine-Ph-PEG5-NHS ester 98% (CAS 1682653-80-0) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A756366-10mg |
| cas | 1682653-80-0 |
| size | 10mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10mg | 548.38 Pln | |
| Ambeed | 25mg | 1026.75 Pln | |
| Ambeed | 50mg | 1983.50 Pln | |
| Ambeed | 100mg | 3496.50 Pln | |
| Ambeed | 250mg | 6533.62 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A756366 |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[3-oxo-3-[[4-(1,2,4,5-tetrazin-3-yl)phenyl]methylamino]propoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1682653-80-0) is a chemical compound with the molecular formula C27H36N6O10 and a molecular weight of 604.6 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[3-oxo-3-[[4-(1,2,4,5-tetrazin-3-yl)phenyl]methylamino]propoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: DUPHIQYIPUTDJS-UHFFFAOYSA-N.
| Molecular formula | C27H36N6O10 |
|---|---|
| Molecular weight | 604.6 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[3-oxo-3-[[4-(1,2,4,5-tetrazin-3-yl)phenyl]methylamino]propoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | DUPHIQYIPUTDJS-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCOCCC(=O)NCC2=CC=C(C=C2)C3=NN=CN=N3 |
Computed by PubChem (NCBI)