cas: 5054-59-1 — see every product listed under this CAS number, including other names
Thalidomide-4-OH 97% (CAS 5054-59-1) is a chemical reagent available from Chemat. Available pack sizes: 500g, 1mg, 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A269268-500g |
| cas | 5054-59-1 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 11656.69 Pln | |
| Ambeed | 1mg | 120.06 Pln | |
| Ambeed | 100mg | 131.19 Pln | |
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 225.75 Pln | |
| Ambeed | 25g | 798.69 Pln | |
| Ambeed | 100g | 2968.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A269268 |
2-(2,6-dioxopiperidin-3-yl)-4-hydroxyisoindole-1,3-dione (CAS 5054-59-1) is a chemical compound with the molecular formula C13H10N2O5 and a molecular weight of 274.23 g/mol. IUPAC name: 2-(2,6-dioxopiperidin-3-yl)-4-hydroxyisoindole-1,3-dione. InChIKey: XMPJICVFSDYOEG-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O5 |
|---|---|
| Molecular weight | 274.23 g/mol |
| IUPAC name | 2-(2,6-dioxopiperidin-3-yl)-4-hydroxyisoindole-1,3-dione |
| InChIKey | XMPJICVFSDYOEG-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)O |
Computed by PubChem (NCBI)