cas: 5054-59-1 — see every product listed under this CAS number, including other names
2-(2,6-Dioxopiperidin-3-yl)-4-hydroxyisoindoline-1,3-dione, 95% (CAS 5054-59-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F546897-250MG |
| cas | 5054-59-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 91.65 Pln | |
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 206.20 Pln | |
| Fluorochem | 10g | 351.98 Pln | |
| Fluorochem | 25g | 789.32 Pln | |
| Fluorochem | 100g | 2970.85 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-(2,6-dioxopiperidin-3-yl)-4-hydroxyisoindole-1,3-dione (CAS 5054-59-1) is a chemical compound with the molecular formula C13H10N2O5 and a molecular weight of 274.23 g/mol. IUPAC name: 2-(2,6-dioxopiperidin-3-yl)-4-hydroxyisoindole-1,3-dione. InChIKey: XMPJICVFSDYOEG-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O5 |
|---|---|
| Molecular weight | 274.23 g/mol |
| IUPAC name | 2-(2,6-dioxopiperidin-3-yl)-4-hydroxyisoindole-1,3-dione |
| InChIKey | XMPJICVFSDYOEG-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)O |
Computed by PubChem (NCBI)