cas: 2412056-27-8 — see every product listed under this CAS number, including other names
Thalidomide-5-NH2-CH2-COOH 97% (CAS 2412056-27-8) is a chemical reagent available from Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1532341-2mg |
| cas | 2412056-27-8 |
| size | 2mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 2mg | 220.19 Pln | |
| Ambeed | 5mg | 253.56 Pln | |
| Ambeed | 10mg | 298.06 Pln | |
| Ambeed | 25mg | 364.81 Pln | |
| Ambeed | 50mg | 448.25 Pln | |
| Ambeed | 100mg | 776.44 Pln | |
| Ambeed | 250mg | 1460.62 Pln | |
| Ambeed | 1g | 4269.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1532341 |
2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]acetic acid (CAS 2412056-27-8) is a chemical compound with the molecular formula C15H13N3O6 and a molecular weight of 331.28 g/mol. IUPAC name: 2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]acetic acid. InChIKey: ZATMCTCUKSYXHM-UHFFFAOYSA-N.
| Molecular formula | C15H13N3O6 |
|---|---|
| Molecular weight | 331.28 g/mol |
| IUPAC name | 2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]acetic acid |
| InChIKey | ZATMCTCUKSYXHM-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C=C(C=C3)NCC(=O)O |
Computed by PubChem (NCBI)