CAS 2412056-27-8 appears in our catalog under these names: Thalidomide-5-NH2-CH2-COOH/ 95.95% (existing batch purity), Thalidomide–5–NH2–CH2–COOH, Thalidomide-5-NH2-CH2-COOH 97%, (2-(2,6-Dioxopiperidin-3-yl)-1,3-dioxoisoindolin-5-yl)glycine, 97%, 97%, Thalidomide-5-NH2-CH2-COOH, 96.03%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1g, 500mg.
2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]acetic acid (CAS 2412056-27-8) is a chemical compound with the molecular formula C15H13N3O6 and a molecular weight of 331.28 g/mol. IUPAC name: 2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]acetic acid. InChIKey: ZATMCTCUKSYXHM-UHFFFAOYSA-N.
| Molecular formula | C15H13N3O6 |
|---|---|
| Molecular weight | 331.28 g/mol |
| IUPAC name | 2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]acetic acid |
| InChIKey | ZATMCTCUKSYXHM-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C=C(C=C3)NCC(=O)O |
Computed by PubChem (NCBI)