CAS 2245697-88-3 appears in our catalog under these names: Thalidomide-O-C6-NH2 hydrochloride/ 97.45% (existing batch purity), Thalidomide 4'–ether–alkylC6–amine, 4-((6-aminohexyl)oxy)-2-(2,6-dioxopiperidin-3-yl)isoindoline-1,3-dione hydrochloride, 95%, 95%, Thalidomide-4-O-C6-NH2 (hydrochloride), 98.87%, Thalidomide-4-O-C6-NH2 hydrochloride, 95%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g, 5 g.
4-(6-aminohexoxy)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;hydrochloride (CAS 2245697-88-3) is a chemical compound with the molecular formula C19H24ClN3O5 and a molecular weight of 409.9 g/mol. IUPAC name: 4-(6-aminohexoxy)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;hydrochloride. InChIKey: HYHUBACBCPALHK-UHFFFAOYSA-N.
| Molecular formula | C19H24ClN3O5 |
|---|---|
| Molecular weight | 409.9 g/mol |
| IUPAC name | 4-(6-aminohexoxy)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;hydrochloride |
| InChIKey | HYHUBACBCPALHK-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)OCCCCCCN.Cl |
Computed by PubChem (NCBI)