Thieno[3,2-b]thiophene-2,5-dicarbaldehyde, 97%
cas: 37882-75-0 — see every product listed under this CAS number, including other names
Thieno[3,2-b]thiophene-2,5-dicarbaldehyde, 97% (CAS 37882-75-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F340324-100MG |
| cas | 37882-75-0 |
| size | 100mg |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 133.30 Pln | |
| Fluorochem | 250mg | 174.96 Pln | |
| Fluorochem | 1g | 331.15 Pln | |
| Fluorochem | 5g | 1164.19 Pln | |
| Fluorochem | 10g | 2241.94 Pln | |
| Fluorochem | 25g | 5079.48 Pln | |
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 995.60 Pln | |
| Chemat | 10g | 1883.60 Pln | |
| Chemat | 25g | 3251.60 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
Thieno[3,2-b]thiophene-2,5-dicarbaldehyde (CAS 37882-75-0) is a chemical compound with the molecular formula C8H4O2S2 and a molecular weight of 196.3 g/mol. IUPAC name: thieno[3,2-b]thiophene-2,5-dicarbaldehyde. InChIKey: UBKNFAFBINVTOP-UHFFFAOYSA-N.
| Molecular formula | C8H4O2S2 |
|---|---|
| Molecular weight | 196.3 g/mol |
| IUPAC name | thieno[3,2-b]thiophene-2,5-dicarbaldehyde |
| InChIKey | UBKNFAFBINVTOP-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=C1SC(=C2)C=O)C=O |
Computed by PubChem (NCBI)