CAS 37882-75-0 appears in our catalog under these names: Thieno(3,2–b)thiophene–2,5–dicarbaldehyde, Thieno[3,2-b]thiophene-2,5-dicarboxaldehyde, >93.0%(GC), Thieno[3,2-b]thiophene-2,5-dicarbaldehyde 93%, THIENO[3,2-B]THIOPHENE-2,5-DICARBOXALD, Thieno[3,2-b]thiophene-2,5-dicarbaldehyde, 97%, 97%. Offered by: GLPBio, TCI, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 250mg, 5g, 200mg, 100mg, 25g, 10g.
Thieno[3,2-b]thiophene-2,5-dicarbaldehyde (CAS 37882-75-0) is a chemical compound with the molecular formula C8H4O2S2 and a molecular weight of 196.3 g/mol. IUPAC name: thieno[3,2-b]thiophene-2,5-dicarbaldehyde. InChIKey: UBKNFAFBINVTOP-UHFFFAOYSA-N.
| Molecular formula | C8H4O2S2 |
|---|---|
| Molecular weight | 196.3 g/mol |
| IUPAC name | thieno[3,2-b]thiophene-2,5-dicarbaldehyde |
| InChIKey | UBKNFAFBINVTOP-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=C1SC(=C2)C=O)C=O |
Computed by PubChem (NCBI)