CAS 154413-61-3 appears in our catalog under these names: Ticolubant/ 99.33% (existing batch purity), Ticolubant, SB-209247, 99.33%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 200mg.
(E)-3-[6-[(2,6-dichlorophenyl)sulfanylmethyl]-3-(2-phenylethoxy)-2-pyridinyl]prop-2-enoic acid (CAS 154413-61-3) is a chemical compound with the molecular formula C23H19Cl2NO3S and a molecular weight of 460.4 g/mol. IUPAC name: (E)-3-[6-[(2,6-dichlorophenyl)sulfanylmethyl]-3-(2-phenylethoxy)-2-pyridinyl]prop-2-enoic acid. InChIKey: ZJLFOOWTDISDIO-ZRDIBKRKSA-N.
| Molecular formula | C23H19Cl2NO3S |
|---|---|
| Molecular weight | 460.4 g/mol |
| IUPAC name | (E)-3-[6-[(2,6-dichlorophenyl)sulfanylmethyl]-3-(2-phenylethoxy)-2-pyridinyl]prop-2-enoic acid |
| InChIKey | ZJLFOOWTDISDIO-ZRDIBKRKSA-N |
| SMILES | C1=CC=C(C=C1)CCOC2=C(N=C(C=C2)CSC3=C(C=CC=C3Cl)Cl)/C=C/C(=O)O |
Computed by PubChem (NCBI)