cas: 328898-40-4 — see every product listed under this CAS number, including other names
Tildipirosin, 98%, 98% (CAS 328898-40-4) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 10g, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C7I2-1mg |
| cas | 328898-40-4 |
| size | 1mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 78.80 Pln | |
| Chemat | 5mg | 83.60 Pln | |
| Chemat | 10mg | 88.40 Pln | |
| Chemat | 25mg | 93.20 Pln | |
| Chemat | 10g | 1562.00 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 366.80 Pln | |
| Chemat | 5g | 1000.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4R,5S,6S,7R,9R,11E,13E,15R,16R)-6-[(2R,3R,4S,5S,6R)-4-(dimethylamino)-3,5-dihydroxy-6-methyloxan-2-yl]oxy-16-ethyl-4-hydroxy-5,9,13-trimethyl-7-(2-piperidin-1-ylethyl)-15-(piperidin-1-ylmethyl)-1-oxacyclohexadeca-11,13-diene-2,10-dione (CAS 328898-40-4) is a chemical compound with the molecular formula C41H71N3O8 and a molecular weight of 734.0 g/mol. IUPAC name: (4R,5S,6S,7R,9R,11E,13E,15R,16R)-6-[(2R,3R,4S,5S,6R)-4-(dimethylamino)-3,5-dihydroxy-6-methyloxan-2-yl]oxy-16-ethyl-4-hydroxy-5,9,13-trimethyl-7-(2-piperidin-1-ylethyl)-15-(piperidin-1-ylmethyl)-1-oxacyclohexadeca-11,13-diene-2,10-dione. InChIKey: HNDXPZPJZGTJLJ-UEJFNEDBSA-N.
| Molecular formula | C41H71N3O8 |
|---|---|
| Molecular weight | 734.0 g/mol |
| IUPAC name | (4R,5S,6S,7R,9R,11E,13E,15R,16R)-6-[(2R,3R,4S,5S,6R)-4-(dimethylamino)-3,5-dihydroxy-6-methyloxan-2-yl]oxy-16-ethyl-4-hydroxy-5,9,13-trimethyl-7-(2-piperidin-1-ylethyl)-15-(piperidin-1-ylmethyl)-1-oxacyclohexadeca-11,13-diene-2,10-dione |
| InChIKey | HNDXPZPJZGTJLJ-UEJFNEDBSA-N |
| SMILES | CC[C@@H]1[C@H](/C=C(/C=C/C(=O)[C@@H](C[C@@H]([C@@H]([C@H]([C@@H](CC(=O)O1)O)C)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C)O)N(C)C)O)CCN3CCCCC3)C)\C)CN4CCCCC4 |
Computed by PubChem (NCBI)