CAS 58433-11-7 appears in our catalog under these names: Tilomisole/ 98.75% (existing batch purity), Tilomisole. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1 mg.
2-[1-(4-chlorophenyl)-[1,3]thiazolo[3,2-a]benzimidazol-2-yl]acetic acid (CAS 58433-11-7) is a chemical compound with the molecular formula C17H11ClN2O2S and a molecular weight of 342.8 g/mol. IUPAC name: 2-[1-(4-chlorophenyl)-[1,3]thiazolo[3,2-a]benzimidazol-2-yl]acetic acid. InChIKey: PUYFLGQZLHVTHX-UHFFFAOYSA-N.
| Molecular formula | C17H11ClN2O2S |
|---|---|
| Molecular weight | 342.8 g/mol |
| IUPAC name | 2-[1-(4-chlorophenyl)-[1,3]thiazolo[3,2-a]benzimidazol-2-yl]acetic acid |
| InChIKey | PUYFLGQZLHVTHX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C3N2C(=C(S3)CC(=O)O)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)