CAS 260980-89-0 appears in our catalog under these names: Topilutamide/ 98.54% (existing batch purity), Topilutamide (BP766), Topilutamide, Topilutamide, 99.91%, Topilutamide (Standard). Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 200mg.
2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]-3-[(2,2,2-trifluoroacetyl)amino]propanamide (CAS 260980-89-0) is a chemical compound with the molecular formula C13H11F6N3O5 and a molecular weight of 403.23 g/mol. IUPAC name: 2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]-3-[(2,2,2-trifluoroacetyl)amino]propanamide. InChIKey: YCNCRLKXSLARFT-UHFFFAOYSA-N.
| Molecular formula | C13H11F6N3O5 |
|---|---|
| Molecular weight | 403.23 g/mol |
| IUPAC name | 2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]-3-[(2,2,2-trifluoroacetyl)amino]propanamide |
| InChIKey | YCNCRLKXSLARFT-UHFFFAOYSA-N |
| SMILES | CC(CNC(=O)C(F)(F)F)(C(=O)NC1=CC(=C(C=C1)[N+](=O)[O-])C(F)(F)F)O |
Computed by PubChem (NCBI)