Products 2062661-53-2
CAS 2062661-53-2 appears in our catalog under these names: Tovinontrine, Tovinontrine/ 98.14% (existing batch purity), Tovinontrine, 99.83%, Tovinontrine, 99%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 10mM (in 1ml dmso), 25mg, 50mg, 10 mg, 25 mg.
6-[(3S,4S)-4-methyl-1-(pyrimidin-2-ylmethyl)pyrrolidin-3-yl]-3-(oxan-4-yl)-7H-imidazo[1,5-a]pyrazin-8-one (CAS 2062661-53-2) is a chemical compound with the molecular formula C21H26N6O2 and a molecular weight of 394.5 g/mol. IUPAC name: 6-[(3S,4S)-4-methyl-1-(pyrimidin-2-ylmethyl)pyrrolidin-3-yl]-3-(oxan-4-yl)-7H-imidazo[1,5-a]pyrazin-8-one. InChIKey: GWGNPYYVGANHRJ-GDBMZVCRSA-N.
| Molecular formula | C21H26N6O2 |
|---|---|
| Molecular weight | 394.5 g/mol |
| IUPAC name | 6-[(3S,4S)-4-methyl-1-(pyrimidin-2-ylmethyl)pyrrolidin-3-yl]-3-(oxan-4-yl)-7H-imidazo[1,5-a]pyrazin-8-one |
| InChIKey | GWGNPYYVGANHRJ-GDBMZVCRSA-N |
| SMILES | C[C@@H]1CN(C[C@H]1C2=CN3C(=CN=C3C4CCOCC4)C(=O)N2)CC5=NC=CC=N5 |
Computed by PubChem (NCBI)