CAS 1212106-36-9 appears in our catalog under these names: Trans (+/-) 3-amino-4-(4-methylphenyl)pyrrolidine-1-carboxylic acid tert-butyl ester, 95%, trans-tert-butyl 3-amino-4-(p-tolyl)pyrrolidine-1-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
Tert-butyl (3S,4R)-3-amino-4-(4-methylphenyl)pyrrolidine-1-carboxylate (CAS 1212106-36-9) is a chemical compound with the molecular formula C16H24N2O2 and a molecular weight of 276.37 g/mol. IUPAC name: tert-butyl (3S,4R)-3-amino-4-(4-methylphenyl)pyrrolidine-1-carboxylate. InChIKey: RLAPHVKVTWWOCS-UONOGXRCSA-N.
| Molecular formula | C16H24N2O2 |
|---|---|
| Molecular weight | 276.37 g/mol |
| IUPAC name | tert-butyl (3S,4R)-3-amino-4-(4-methylphenyl)pyrrolidine-1-carboxylate |
| InChIKey | RLAPHVKVTWWOCS-UONOGXRCSA-N |
| SMILES | CC1=CC=C(C=C1)[C@@H]2CN(C[C@H]2N)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)