cas: 81846-19-7 — see every product listed under this CAS number, including other names
Treprostinil 98% (CAS 81846-19-7) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A465916-1mg |
| cas | 81846-19-7 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 153.44 Pln | |
| Ambeed | 5mg | 270.25 Pln | |
| Ambeed | 10mg | 381.50 Pln | |
| Ambeed | 25mg | 620.69 Pln | |
| Ambeed | 50mg | 1021.19 Pln | |
| Ambeed | 100mg | 1482.88 Pln | |
| Ambeed | 250mg | 2428.50 Pln | |
| Ambeed | 1g | 6433.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A465916 |
Treprostinil is a carboxylic acid and a carbotricyclic compound. It has a role as a cardiovascular drug, a vasodilator agent, an antihypertensive agent, a platelet aggregation inhibitor, a vitamin K antagonist and a human blood serum metabolite.
Source: ChEBI
| Molecular formula | C23H34O5 |
|---|---|
| Molecular weight | 390.5 g/mol |
| IUPAC name | 2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid |
| InChIKey | PAJMKGZZBBTTOY-ZFORQUDYSA-N |
| SMILES | CCCCC[C@@H](CC[C@H]1[C@@H](C[C@H]2[C@@H]1CC3=C(C2)C(=CC=C3)OCC(=O)O)O)O |
Computed by PubChem (NCBI)