CAS 903549-49-5 appears in our catalog under these names: 5-trans Latanoprost (free acid), 5–trans Latanoprost (free acid), Latanoprost Impurity 16, trans-Latanoprost Acid, trans-Latanoprost acid. Offered by: TargetMol, GLPBio, Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 5 mg.
(E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoic acid (CAS 903549-49-5) is a chemical compound with the molecular formula C23H34O5 and a molecular weight of 390.5 g/mol. IUPAC name: (E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoic acid. InChIKey: HNPFPERDNWXAGS-MIDWJBHHSA-N.
| Molecular formula | C23H34O5 |
|---|---|
| Molecular weight | 390.5 g/mol |
| IUPAC name | (E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoic acid |
| InChIKey | HNPFPERDNWXAGS-MIDWJBHHSA-N |
| SMILES | C1[C@H]([C@@H]([C@H]([C@H]1O)C/C=C/CCCC(=O)O)CC[C@H](CCC2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)