cas: 289480-64-4 — see every product listed under this CAS number, including other names
Treprostinil sodium, 97%, 97% (CAS 289480-64-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BFH3-1g |
| cas | 289480-64-4 |
| size | 1g |
| availability | 5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 16384.40 Pln | |
| Chemat | 1mg | 165.20 Pln | |
| Chemat | 5mg | 390.80 Pln | |
| Chemat | 10mg | 554.00 Pln | |
| Chemat | 25mg | 904.40 Pln | |
| Chemat | 50mg | 1504.40 Pln | |
| Chemat | 100mg | 2166.80 Pln | |
| Chemat | 250mg | 5162.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
CAS 289480-64-4 identifies a chemical compound with the molecular formula C23H34NaO5 and a molecular weight of 413.5 g/mol. InChIKey: RCKWZOAISRYANP-ZSESPEEFSA-N.
| Molecular formula | C23H34NaO5 |
|---|---|
| Molecular weight | 413.5 g/mol |
| InChIKey | RCKWZOAISRYANP-ZSESPEEFSA-N |
| SMILES | CCCCC[C@@H](CC[C@H]1[C@@H](C[C@H]2[C@@H]1CC3=C(C2)C(=CC=C3)OCC(=O)O)O)O.[Na] |
Computed by PubChem (NCBI)