CAS 289480-64-4 appears in our catalog under these names: Treprostinil Sodium/ 99.95% (existing batch purity), Treprostinil sodium (UT–15), Treprostinil sodium 97%, Treprostinil sodium, 97%, 97%, Treprostinil (sodium), 99.78%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 10mM (in 1ml dmso), 1g, 100mg.
CAS 289480-64-4 identifies a chemical compound with the molecular formula C23H34NaO5 and a molecular weight of 413.5 g/mol. InChIKey: RCKWZOAISRYANP-ZSESPEEFSA-N.
| Molecular formula | C23H34NaO5 |
|---|---|
| Molecular weight | 413.5 g/mol |
| InChIKey | RCKWZOAISRYANP-ZSESPEEFSA-N |
| SMILES | CCCCC[C@@H](CC[C@H]1[C@@H](C[C@H]2[C@@H]1CC3=C(C2)C(=CC=C3)OCC(=O)O)O)O.[Na] |
Computed by PubChem (NCBI)