CAS 4640-01-1 appears in our catalog under these names: Triclosan methyl ether, 98%, Triclosan-Methyl, Triclosan Methyl Ether, >95% (HPLC), Triclosan-methyl ether, Triclosan-methyl ether 100 µg/mL in Acetonitrile. Offered by: Combi-blocks, Chemat Brand, TRC, Dr. Ehrenstorfer, Sigma-Aldrich. Available pack sizes: 5g, 1g, on request, 100mg, 10mg, 50mg, 1ml, 1x100mg.
2,4-dichloro-1-(4-chloro-2-methoxyphenoxy)benzene (CAS 4640-01-1) is a chemical compound with the molecular formula C13H9Cl3O2 and a molecular weight of 303.6 g/mol. IUPAC name: 2,4-dichloro-1-(4-chloro-2-methoxyphenoxy)benzene. InChIKey: NLYDHBBTVWMLFD-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl3O2 |
|---|---|
| Molecular weight | 303.6 g/mol |
| IUPAC name | 2,4-dichloro-1-(4-chloro-2-methoxyphenoxy)benzene |
| InChIKey | NLYDHBBTVWMLFD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)Cl)OC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)