Products 13532-25-7
CAS 13532-25-7 appears in our catalog under these names: Trietazine-2-hydroxy, Trietazine-2-hydroxy 10 µg/mL in Acetonitrile, Trietazine-2-hydroxy, Concentration: 100 µg/ml Solvent: Acetone, Trietazine-2-hydroxy, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 25mg, 10ml, 1x1ml.
4-(diethylamino)-6-(ethylamino)-1H-1,3,5-triazin-2-one (CAS 13532-25-7) is a chemical compound with the molecular formula C9H17N5O and a molecular weight of 211.26 g/mol. IUPAC name: 4-(diethylamino)-6-(ethylamino)-1H-1,3,5-triazin-2-one. InChIKey: XLEPYYLPBFNICY-UHFFFAOYSA-N.
| Molecular formula | C9H17N5O |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | 4-(diethylamino)-6-(ethylamino)-1H-1,3,5-triazin-2-one |
| InChIKey | XLEPYYLPBFNICY-UHFFFAOYSA-N |
| SMILES | CCNC1=NC(=NC(=O)N1)N(CC)CC |
Computed by PubChem (NCBI)