cas: 18412-57-2 — see every product listed under this CAS number, including other names
Triethoxy(p-tolyl)silane, 97%, 97% (CAS 18412-57-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ACFX-1g |
| cas | 18412-57-2 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 246.80 Pln | |
| Chemat | 10g | 405.20 Pln | |
| Chemat | 25g | 755.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Triethoxy-(4-methylphenyl)silane (CAS 18412-57-2) is a chemical compound with the molecular formula C13H22O3Si and a molecular weight of 254.40 g/mol. IUPAC name: triethoxy-(4-methylphenyl)silane. InChIKey: PADYPAQRESYCQZ-UHFFFAOYSA-N.
| Molecular formula | C13H22O3Si |
|---|---|
| Molecular weight | 254.40 g/mol |
| IUPAC name | triethoxy-(4-methylphenyl)silane |
| InChIKey | PADYPAQRESYCQZ-UHFFFAOYSA-N |
| SMILES | CCO[Si](C1=CC=C(C=C1)C)(OCC)OCC |
Computed by PubChem (NCBI)