CAS 22365-40-8 appears in our catalog under these names: Triflubazam/ 97.09% (existing batch purity), Triflubazam. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 5 mg.
1-methyl-5-phenyl-7-(trifluoromethyl)-1,5-benzodiazepine-2,4-dione (CAS 22365-40-8) is a chemical compound with the molecular formula C17H13F3N2O2 and a molecular weight of 334.29 g/mol. IUPAC name: 1-methyl-5-phenyl-7-(trifluoromethyl)-1,5-benzodiazepine-2,4-dione. InChIKey: DMNPCIKBNDKNTO-UHFFFAOYSA-N.
| Molecular formula | C17H13F3N2O2 |
|---|---|
| Molecular weight | 334.29 g/mol |
| IUPAC name | 1-methyl-5-phenyl-7-(trifluoromethyl)-1,5-benzodiazepine-2,4-dione |
| InChIKey | DMNPCIKBNDKNTO-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CC(=O)N(C2=C1C=CC(=C2)C(F)(F)F)C3=CC=CC=C3 |
Computed by PubChem (NCBI)