Triisopropylphosphonium tetrafluoroborate, 98%
cas: 121099-07-8 — see every product listed under this CAS number, including other names
Triisopropylphosphonium tetrafluoroborate, 98% (CAS 121099-07-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A356704-250mg |
| cas | 121099-07-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 520.56 Pln | |
| Ambeed | 5g | 1577.44 Pln | |
| Ambeed | 10g | 2484.12 Pln | |
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 1g | 410.00 Pln | |
| BLDpharm | 100mg | 214.39 Pln | |
| BLDpharm | 250mg | 269.93 Pln | |
| BLDpharm | 1g | 553.16 Pln | |
| BLDpharm | 5g | 2008.21 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Tri(propan-2-yl)phosphanium tetrafluoroborate (CAS 121099-07-8) is a chemical compound with the molecular formula C9H22BF4P and a molecular weight of 248.05 g/mol. IUPAC name: tri(propan-2-yl)phosphanium tetrafluoroborate. InChIKey: KGBIZABAOCDZNU-UHFFFAOYSA-O.
| Molecular formula | C9H22BF4P |
|---|---|
| Molecular weight | 248.05 g/mol |
| IUPAC name | tri(propan-2-yl)phosphanium tetrafluoroborate |
| InChIKey | KGBIZABAOCDZNU-UHFFFAOYSA-O |
| SMILES | [B-](F)(F)(F)F.CC(C)[PH+](C(C)C)C(C)C |
Computed by PubChem (NCBI)
Synonyms:
TRIISOPROPYLPHOSPHONIUM TETRAFLUOROBORATE, Tri-i-propylphosphonium tetrafluoroborate, tri(propan-2-yl)phosphanium;tetrafluoroborate, tris(isopropyl)phosphonium tetrafluoroborate, Tris(1-methylethyl)phosphine tetrafluoroborate, Triisopropylphosphine Tetrafluoroborate, triisopropylphosphonium;tetrafluoroborate, Triisopropylphosphonium tetrafluoroborate 97%, Triisopropylphosphonium tetrafluoroborate, 97%, TRIISOPROPYLPHOSPHONIUMTETRAFLUOROBORATE