CAS 479094-62-7 appears in our catalog under these names: Di–t–butylmethylphosphonium tetrafluoroborate, Di–tert–butyl(methyl)phosphonium Tetrafluoroborate, Di-tert-butyl(methyl)phosphonium Tetrafluoroborate, >98.0%(T), Di-t-butylmethylphosphonium tetrafluoroborate, Di-tert-butyl(methyl)phosphonium tetrafluoroborate 98%. Offered by: GLPBio, TCI, Thermo Scientific (Acros), Ambeed, Sigma-Aldrich. Available pack sizes: 10g, 1g, 25g, 5g, 250mg, 100g.
Ditert-butyl(methyl)phosphanium tetrafluoroborate (CAS 479094-62-7) is a chemical compound with the molecular formula C9H22BF4P and a molecular weight of 248.05 g/mol. IUPAC name: ditert-butyl(methyl)phosphanium tetrafluoroborate. InChIKey: BRDLRXCAHKUWJS-UHFFFAOYSA-O.
| Molecular formula | C9H22BF4P |
|---|---|
| Molecular weight | 248.05 g/mol |
| IUPAC name | ditert-butyl(methyl)phosphanium tetrafluoroborate |
| InChIKey | BRDLRXCAHKUWJS-UHFFFAOYSA-O |
| SMILES | [B-](F)(F)(F)F.CC(C)(C)[PH+](C)C(C)(C)C |
Computed by PubChem (NCBI)