cas: 1095-03-0 — see every product listed under this CAS number, including other names
Triphenyl Borate, >96.0%(T) (CAS 1095-03-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 500g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B0524-25G |
| cas | 1095-03-0 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 518.13 Pln | |
| TCI | 500g | 4584.70 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >96.0%(T) |
Triphenyl borate (CAS 1095-03-0) is a chemical compound with the molecular formula C18H15BO3 and a molecular weight of 290.1 g/mol. IUPAC name: triphenyl borate. InChIKey: MDCWDBMBZLORER-UHFFFAOYSA-N.
| Molecular formula | C18H15BO3 |
|---|---|
| Molecular weight | 290.1 g/mol |
| IUPAC name | triphenyl borate |
| InChIKey | MDCWDBMBZLORER-UHFFFAOYSA-N |
| SMILES | B(OC1=CC=CC=C1)(OC2=CC=CC=C2)OC3=CC=CC=C3 |
Computed by PubChem (NCBI)